C33H38O8 — CID 146667925
[4-[3-[(E)-3-(4-butylcyclohexyl)prop-2-enoyl]oxy-4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 146667925) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is [4-[3-[(E)-3-(4-butylcyclohexyl)prop-2-enoyl]oxy-4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[3-[(E)-3-(4-butylcyclohexyl)prop-2-enoyl]oxy-4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 146667925 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [4-[3-[(E)-3-(4-butylcyclohexyl)prop-2-enoyl]oxy-4-[2-(hydroxymethyl)prop-2-enoyloxy]phenyl]phenyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)Oc1ccc(-c2ccc(OC(=O)C(=C)CO)c(OC(=O)/C=C/C3CCC(CCCC)CC3)c2)cc1 |
| InChI | InChI=1S/C33H38O8/c1-4-5-6-24-7-9-25(10-8-24)11-18-31(36)40-30-19-27(14-17-29(30)41-33(38)23(3)21-35)26-12-15-28(16-13-26)39-32(37)22(2)20-34/h11-19,24-25,34-35H,2-10,20-21H2,1H3/b18-11+ |
| InChIKey | IASYCJTVUMHBQZ-WOJGMQOQSA-N |
| XLogP | 5.72 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|