C35H43F3O8 — CID 135172816
[4-[3-ethyl-4-[4-(5,5,5-trifluoropentyl)cyclohexyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135172816) has the molecular formula C35H43F3O8 and a molecular weight of 648.71 g/mol. Its IUPAC name is [4-[3-ethyl-4-[4-(5,5,5-trifluoropentyl)cyclohexyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[3-ethyl-4-[4-(5,5,5-trifluoropentyl)cyclohexyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135172816 |
| Molecular Formula | C35H43F3O8 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | [4-[3-ethyl-4-[4-(5,5,5-trifluoropentyl)cyclohexyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethoxy]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCOc1ccc(-c2ccc(C3CCC(CCCCC(F)(F)F)CC3)c(CC)c2)cc1OCOC(=O)C(=C)CO |
| InChI | InChI=1S/C35H43F3O8/c1-4-26-17-28(12-14-30(26)27-10-8-25(9-11-27)7-5-6-16-35(36,37)38)29-13-15-31(43-21-45-33(41)23(2)19-39)32(18-29)44-22-46-34(42)24(3)20-40/h12-15,17-18,25,27,39-40H,2-11,16,19-22H2,1H3 |
| InChIKey | IYKZZLFLCDWHPG-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|