C28H26O6 — CID 121338886
[4-[4-[3-oxo-3-(4-prop-2-enoyloxyphenoxy)propyl]cyclohexa-1,5-dien-1-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 121338886) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is [4-[4-[3-oxo-3-(4-prop-2-enoyloxyphenoxy)propyl]cyclohexa-1,5-dien-1-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[3-oxo-3-(4-prop-2-enoyloxyphenoxy)propyl]cyclohexa-1,5-dien-1-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121338886 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [4-[4-[3-oxo-3-(4-prop-2-enoyloxyphenoxy)propyl]cyclohexa-1,5-dien-1-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)CCC2C=CC(c3ccc(OC(=O)C(=C)C)cc3)=CC2)cc1 |
| InChI | InChI=1S/C28H26O6/c1-4-26(29)32-23-14-16-24(17-15-23)33-27(30)18-7-20-5-8-21(9-6-20)22-10-12-25(13-11-22)34-28(31)19(2)3/h4-5,8-17,20H,1-2,6-7,18H2,3H3 |
| InChIKey | WJBXXRRXNXPYCG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|