C37H28F2O8 — CID 126611178
[4-[4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 126611178) has the molecular formula C37H28F2O8 and a molecular weight of 638.62 g/mol. Its IUPAC name is [4-[4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126611178 |
| Molecular Formula | C37H28F2O8 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | [4-[4-[4-[3-[3,4-di(prop-2-enoyloxy)phenyl]propanoyloxy]phenyl]-2,3-difluorophenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(CCC(=O)Oc2ccc(-c3ccc(-c4ccc(OC(=O)C(=C)C)cc4)c(F)c3F)cc2)cc1OC(=O)C=C |
| InChI | InChI=1S/C37H28F2O8/c1-5-32(40)46-30-19-7-23(21-31(30)47-33(41)6-2)8-20-34(42)44-26-13-9-24(10-14-26)28-17-18-29(36(39)35(28)38)25-11-15-27(16-12-25)45-37(43)22(3)4/h5-7,9-19,21H,1-3,8,20H2,4H3 |
| InChIKey | URGXLMGJVHLWBN-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|