C33H31FO7 — CID 126621373
[4-[4-[3-[3-buta-1,3-dien-2-yloxy-4-(2-methylprop-2-enoyloxy)phenyl]propanoyloxy]-3-fluorophenyl]phenyl] 2-methylpropanoate (PubChem CID 126621373) has the molecular formula C33H31FO7 and a molecular weight of 558.60 g/mol. Its IUPAC name is [4-[4-[3-[3-buta-1,3-dien-2-yloxy-4-(2-methylprop-2-enoyloxy)phenyl]propanoyloxy]-3-fluorophenyl]phenyl] 2-methylpropanoate.
| Compound Name | [4-[4-[3-[3-buta-1,3-dien-2-yloxy-4-(2-methylprop-2-enoyloxy)phenyl]propanoyloxy]-3-fluorophenyl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 126621373 |
| Molecular Formula | C33H31FO7 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | [4-[4-[3-[3-buta-1,3-dien-2-yloxy-4-(2-methylprop-2-enoyloxy)phenyl]propanoyloxy]-3-fluorophenyl]phenyl] 2-methylpropanoate |
| SMILES | C=CC(=C)Oc1cc(CCC(=O)Oc2ccc(-c3ccc(OC(=O)C(C)C)cc3)cc2F)ccc1OC(=O)C(=C)C |
| InChI | InChI=1S/C33H31FO7/c1-7-22(6)38-30-18-23(8-15-29(30)41-33(37)21(4)5)9-17-31(35)40-28-16-12-25(19-27(28)34)24-10-13-26(14-11-24)39-32(36)20(2)3/h7-8,10-16,18-20H,1,4,6,9,17H2,2-3,5H3 |
| InChIKey | BSBNKXXBIOHFNV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|