C24H23F3O3 — CID 54480738
[4-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethynyl]phenyl] hex-2-enoate (PubChem CID 54480738) has the molecular formula C24H23F3O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is [4-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethynyl]phenyl] hex-2-enoate.
| Compound Name | [4-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethynyl]phenyl] hex-2-enoate |
|---|---|
| PubChem CID | 54480738 |
| Molecular Formula | C24H23F3O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [4-[2-[4-(4,4,4-trifluorobutoxy)phenyl]ethynyl]phenyl] hex-2-enoate |
| SMILES | CCCC=CC(=O)Oc1ccc(C#Cc2ccc(OCCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C24H23F3O3/c1-2-3-4-6-23(28)30-22-15-11-20(12-16-22)8-7-19-9-13-21(14-10-19)29-18-5-17-24(25,26)27/h4,6,9-16H,2-3,5,17-18H2,1H3 |
| InChIKey | XOVBDDNNFKEICV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|