C31H48O4 — CID 134193678
2-[2-[4-(3-hydroxypropyl)cyclohexyl]-5-(4-pentylcyclohexyl)phenoxy]ethyl prop-2-enoate (PubChem CID 134193678) has the molecular formula C31H48O4 and a molecular weight of 484.72 g/mol. Its IUPAC name is 2-[2-[4-(3-hydroxypropyl)cyclohexyl]-5-(4-pentylcyclohexyl)phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-(3-hydroxypropyl)cyclohexyl]-5-(4-pentylcyclohexyl)phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134193678 |
| Molecular Formula | C31H48O4 |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | 2-[2-[4-(3-hydroxypropyl)cyclohexyl]-5-(4-pentylcyclohexyl)phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cc(C2CCC(CCCCC)CC2)ccc1C1CCC(CCCO)CC1 |
| InChI | InChI=1S/C31H48O4/c1-3-5-6-8-24-10-14-26(15-11-24)28-18-19-29(27-16-12-25(13-17-27)9-7-20-32)30(23-28)34-21-22-35-31(33)4-2/h4,18-19,23-27,32H,2-3,5-17,20-22H2,1H3 |
| InChIKey | CCPPQUNFERLFCB-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|