C26H42O3 — CID 145122285
3-[4-[4-(4-ethylcyclohexyl)-2-(2-methoxyethoxy)phenyl]cyclohexyl]propan-1-ol (PubChem CID 145122285) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is 3-[4-[4-(4-ethylcyclohexyl)-2-(2-methoxyethoxy)phenyl]cyclohexyl]propan-1-ol.
| Compound Name | 3-[4-[4-(4-ethylcyclohexyl)-2-(2-methoxyethoxy)phenyl]cyclohexyl]propan-1-ol |
|---|---|
| PubChem CID | 145122285 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | 3-[4-[4-(4-ethylcyclohexyl)-2-(2-methoxyethoxy)phenyl]cyclohexyl]propan-1-ol |
| SMILES | CCC1CCC(c2ccc(C3CCC(CCCO)CC3)c(OCCOC)c2)CC1 |
| InChI | InChI=1S/C26H42O3/c1-3-20-6-10-22(11-7-20)24-14-15-25(26(19-24)29-18-17-28-2)23-12-8-21(9-13-23)5-4-16-27/h14-15,19-23,27H,3-13,16-18H2,1-2H3 |
| InChIKey | QTAPEGOQBDPPJW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|