C27H42O4 — CID 145411625
[2-[4-(4-heptylcyclohexyl)phenyl]-3-hydroxy-2-methylpropyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411625) has the molecular formula C27H42O4 and a molecular weight of 430.63 g/mol. Its IUPAC name is [2-[4-(4-heptylcyclohexyl)phenyl]-3-hydroxy-2-methylpropyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-(4-heptylcyclohexyl)phenyl]-3-hydroxy-2-methylpropyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411625 |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | [2-[4-(4-heptylcyclohexyl)phenyl]-3-hydroxy-2-methylpropyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(C)(CO)c1ccc(C2CCC(CCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C27H42O4/c1-4-5-6-7-8-9-22-10-12-23(13-11-22)24-14-16-25(17-15-24)27(3,19-29)20-31-26(30)21(2)18-28/h14-17,22-23,28-29H,2,4-13,18-20H2,1,3H3 |
| InChIKey | CDFBTIBWUIDLEO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|