C29H42O5 — CID 138529465
[2-methyl-3-(2-methylprop-2-enoyloxy)-2-[4-(4-pentylcyclohexyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 138529465) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [2-methyl-3-(2-methylprop-2-enoyloxy)-2-[4-(4-pentylcyclohexyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-methyl-3-(2-methylprop-2-enoyloxy)-2-[4-(4-pentylcyclohexyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 138529465 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [2-methyl-3-(2-methylprop-2-enoyloxy)-2-[4-(4-pentylcyclohexyl)phenyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(COC(=O)C(=C)CO)c1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C29H42O5/c1-6-7-8-9-23-10-12-24(13-11-23)25-14-16-26(17-15-25)29(5,19-33-27(31)21(2)3)20-34-28(32)22(4)18-30/h14-17,23-24,30H,2,4,6-13,18-20H2,1,3,5H3 |
| InChIKey | UAJNLXYPFQWUNE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|