C40H46O7 — CID 160729976
[3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexen-1-yl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 160729976) has the molecular formula C40H46O7 and a molecular weight of 638.80 g/mol. Its IUPAC name is [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexen-1-yl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexen-1-yl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 160729976 |
| Molecular Formula | C40H46O7 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.32 |
| IUPAC Name | [3-[3-(hydroxymethyl)buta-1,3-dien-2-yloxymethoxy]-5-[4-[4-(4-pentylcyclohexen-1-yl)phenyl]phenyl]phenoxy]methyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=C)OCOc1cc(OCOC(=O)C(=C)CO)cc(-c2ccc(-c3ccc(C4=CCC(CCCCC)CC4)cc3)cc2)c1 |
| InChI | InChI=1S/C40H46O7/c1-5-6-7-8-31-9-11-32(12-10-31)33-13-15-34(16-14-33)35-17-19-36(20-18-35)37-21-38(45-26-44-30(4)28(2)24-41)23-39(22-37)46-27-47-40(43)29(3)25-42/h11,13-23,31,41-42H,2-10,12,24-27H2,1H3 |
| InChIKey | RUEZYBVRBLWPTL-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|