C37H50O4 — CID 134193880
3-[2-[4-(2-hydroxyethoxy)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]propyl prop-2-enoate (PubChem CID 134193880) has the molecular formula C37H50O4 and a molecular weight of 558.80 g/mol. Its IUPAC name is 3-[2-[4-(2-hydroxyethoxy)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]propyl prop-2-enoate.
| Compound Name | 3-[2-[4-(2-hydroxyethoxy)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 134193880 |
| Molecular Formula | C37H50O4 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.37 |
| IUPAC Name | 3-[2-[4-(2-hydroxyethoxy)phenyl]-5-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenyl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1cc(C2=CCC(C3CCC(CCCCC)CC3)CC2)ccc1-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C37H50O4/c1-3-5-6-8-28-10-12-29(13-11-28)30-14-16-31(17-15-30)33-20-23-36(32-18-21-35(22-19-32)40-26-24-38)34(27-33)9-7-25-41-37(39)4-2/h4,16,18-23,27-30,38H,2-3,5-15,17,24-26H2,1H3 |
| InChIKey | HBABAGDFQNCLOI-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|