C29H43NO2 — CID 134244941
N-methyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenoxy]ethyl]prop-2-enamide (PubChem CID 134244941) has the molecular formula C29H43NO2 and a molecular weight of 437.67 g/mol. Its IUPAC name is N-methyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenoxy]ethyl]prop-2-enamide.
| Compound Name | N-methyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134244941 |
| Molecular Formula | C29H43NO2 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | N-methyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexen-1-yl]phenoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CCOc1ccc(C2=CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H43NO2/c1-4-6-7-8-23-9-11-24(12-10-23)25-13-15-26(16-14-25)27-17-19-28(20-18-27)32-22-21-30(3)29(31)5-2/h5,15,17-20,23-25H,2,4,6-14,16,21-22H2,1,3H3 |
| InChIKey | UIFYLPZPTYWAFK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|