C23H29NO2 — CID 134246358
N-[3-[4-(4-butoxyphenyl)phenyl]propyl]-N-methylprop-2-enamide (PubChem CID 134246358) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[3-[4-(4-butoxyphenyl)phenyl]propyl]-N-methylprop-2-enamide.
| Compound Name | N-[3-[4-(4-butoxyphenyl)phenyl]propyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 134246358 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[3-[4-(4-butoxyphenyl)phenyl]propyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCc1ccc(-c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C23H29NO2/c1-4-6-18-26-22-15-13-21(14-16-22)20-11-9-19(10-12-20)8-7-17-24(3)23(25)5-2/h5,9-16H,2,4,6-8,17-18H2,1,3H3 |
| InChIKey | KEHIVLLMTDMBGF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|