C25H33NO — CID 134246359
N,2-dimethyl-N-[3-[4-(4-pentylphenyl)phenyl]propyl]prop-2-enamide (PubChem CID 134246359) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is N,2-dimethyl-N-[3-[4-(4-pentylphenyl)phenyl]propyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[3-[4-(4-pentylphenyl)phenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 134246359 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | N,2-dimethyl-N-[3-[4-(4-pentylphenyl)phenyl]propyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCCc1ccc(-c2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H33NO/c1-5-6-7-9-21-11-15-23(16-12-21)24-17-13-22(14-18-24)10-8-19-26(4)25(27)20(2)3/h11-18H,2,5-10,19H2,1,3-4H3 |
| InChIKey | HGJAFXGHSPOWAQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|