C26H35NO2 — CID 162236405
N-[2-[3-ethyl-4-(4-pentylphenyl)phenoxy]ethyl]-N,2-dimethylprop-2-enamide (PubChem CID 162236405) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is N-[2-[3-ethyl-4-(4-pentylphenyl)phenoxy]ethyl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[2-[3-ethyl-4-(4-pentylphenyl)phenoxy]ethyl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 162236405 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | N-[2-[3-ethyl-4-(4-pentylphenyl)phenoxy]ethyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCOc1ccc(-c2ccc(CCCCC)cc2)c(CC)c1 |
| InChI | InChI=1S/C26H35NO2/c1-6-8-9-10-21-11-13-23(14-12-21)25-16-15-24(19-22(25)7-2)29-18-17-27(5)26(28)20(3)4/h11-16,19H,3,6-10,17-18H2,1-2,4-5H3 |
| InChIKey | ZWCSDGZTWDDCIQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|