C32H39NO2 — CID 134244931
N-[2-[3-ethyl-4-[2-methyl-4-(4-pentylphenyl)phenyl]phenoxy]ethyl]-N-methylprop-2-enamide (PubChem CID 134244931) has the molecular formula C32H39NO2 and a molecular weight of 469.67 g/mol. Its IUPAC name is N-[2-[3-ethyl-4-[2-methyl-4-(4-pentylphenyl)phenyl]phenoxy]ethyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[3-ethyl-4-[2-methyl-4-(4-pentylphenyl)phenyl]phenoxy]ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 134244931 |
| Molecular Formula | C32H39NO2 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | N-[2-[3-ethyl-4-[2-methyl-4-(4-pentylphenyl)phenyl]phenoxy]ethyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCOc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)cc2C)c(CC)c1 |
| InChI | InChI=1S/C32H39NO2/c1-6-9-10-11-25-12-14-27(15-13-25)28-16-18-30(24(4)22-28)31-19-17-29(23-26(31)7-2)35-21-20-33(5)32(34)8-3/h8,12-19,22-23H,3,6-7,9-11,20-21H2,1-2,4-5H3 |
| InChIKey | KKPKEOKGXPUJBL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|