C24H37NO — CID 134246264
N,2-dimethyl-N-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]prop-2-enamide (PubChem CID 134246264) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134246264 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | N,2-dimethyl-N-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCc1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C24H37NO/c1-5-6-7-8-20-9-13-22(14-10-20)23-15-11-21(12-16-23)17-18-25(4)24(26)19(2)3/h11-12,15-16,20,22H,2,5-10,13-14,17-18H2,1,3-4H3 |
| InChIKey | VTPKYZSDAWUUKJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|