C32H44FNO — CID 134245530
N-[3-[4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl]-N-methylprop-2-enamide (PubChem CID 134245530) has the molecular formula C32H44FNO and a molecular weight of 477.71 g/mol. Its IUPAC name is N-[3-[4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl]-N-methylprop-2-enamide.
| Compound Name | N-[3-[4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 134245530 |
| Molecular Formula | C32H44FNO |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | N-[3-[4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]phenyl]propyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCc1ccc(-c2ccc(CCC3CCC(CCCCC)CC3)cc2F)cc1 |
| InChI | InChI=1S/C32H44FNO/c1-4-6-7-9-25-11-13-27(14-12-25)15-16-28-19-22-30(31(33)24-28)29-20-17-26(18-21-29)10-8-23-34(3)32(35)5-2/h5,17-22,24-25,27H,2,4,6-16,23H2,1,3H3 |
| InChIKey | BECCJJSMCCISKV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|