C25H32ClF — CID 139724343
1-chloro-2,3,5,6-tetradeuterio-4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene (PubChem CID 139724343) has the molecular formula C25H32ClF and a molecular weight of 391.01 g/mol. Its IUPAC name is 1-chloro-2,3,5,6-tetradeuterio-4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene.
| Compound Name | 1-chloro-2,3,5,6-tetradeuterio-4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
|---|---|
| PubChem CID | 139724343 |
| Molecular Formula | C25H32ClF |
| Molecular Weight | 391.01 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-chloro-2,3,5,6-tetradeuterio-4-[2-fluoro-4-[2-(4-pentylcyclohexyl)ethyl]phenyl]benzene |
| SMILES | [2H]c1c([2H])c(-c2ccc(CCC3CCC(CCCCC)CC3)cc2F)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C25H32ClF/c1-2-3-4-5-19-6-8-20(9-7-19)10-11-21-12-17-24(25(27)18-21)22-13-15-23(26)16-14-22/h12-20H,2-11H2,1H3/i13D,14D,15D,16D |
| InChIKey | KXNNERUZHVDFHL-DNXUXHMQSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.01 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|