C32H38F2O6 — CID 134246752
[4-[4-[(E)-1,2-difluoro-2-(4-pentylphenyl)ethenyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246752) has the molecular formula C32H38F2O6 and a molecular weight of 556.65 g/mol. Its IUPAC name is [4-[4-[(E)-1,2-difluoro-2-(4-pentylphenyl)ethenyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[(E)-1,2-difluoro-2-(4-pentylphenyl)ethenyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246752 |
| Molecular Formula | C32H38F2O6 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [4-[4-[(E)-1,2-difluoro-2-(4-pentylphenyl)ethenyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCc1ccc(/C(F)=C(\F)c2ccc(CCCCC)cc2)cc1)COC(=O)C(=C)CO |
| InChI | InChI=1S/C32H38F2O6/c1-4-5-6-7-24-10-14-27(15-11-24)29(33)30(34)28-16-12-25(13-17-28)8-9-26(20-39-31(37)22(2)18-35)21-40-32(38)23(3)19-36/h10-17,26,35-36H,2-9,18-21H2,1H3/b30-29+ |
| InChIKey | KFLPWOFRHWGFFU-QVIHXGFCSA-N |
| XLogP | 5.92 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|