C32H41ClO6 — CID 134246766
[4-[3-chloro-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246766) has the molecular formula C32H41ClO6 and a molecular weight of 557.13 g/mol. Its IUPAC name is [4-[3-chloro-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[3-chloro-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246766 |
| Molecular Formula | C32H41ClO6 |
| Molecular Weight | 557.13 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | [4-[3-chloro-4-[2-(4-pentylphenyl)ethyl]phenyl]-2-[2-(hydroxymethyl)prop-2-enoyloxymethyl]butyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(CCc1ccc(CCc2ccc(CCCCC)cc2)c(Cl)c1)COC(=O)C(=C)CO |
| InChI | InChI=1S/C32H41ClO6/c1-4-5-6-7-25-8-10-26(11-9-25)14-16-29-17-15-27(18-30(29)33)12-13-28(21-38-31(36)23(2)19-34)22-39-32(37)24(3)20-35/h8-11,15,17-18,28,34-35H,2-7,12-14,16,19-22H2,1H3 |
| InChIKey | XWCUPDFVAFKXGJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.13 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|