C30H40O6 — CID 134245815
[2-[3-ethyl-4-(4-pentylphenyl)phenyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245815) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is [2-[3-ethyl-4-(4-pentylphenyl)phenyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[3-ethyl-4-(4-pentylphenyl)phenyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245815 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | [2-[3-ethyl-4-(4-pentylphenyl)phenyl]-3-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(O)C(=C)CO)c1ccc(-c2ccc(CCCCC)cc2)c(CC)c1 |
| InChI | InChI=1S/C30H40O6/c1-5-7-8-9-23-10-12-25(13-11-23)28-15-14-26(16-24(28)6-2)27(19-35-29(33)21(3)17-31)20-36-30(34)22(4)18-32/h10-16,27,29,31-33H,3-9,17-20H2,1-2H3 |
| InChIKey | XZQXSHKHMQEIMS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|