C28H44O6 — CID 166645851
[4-(3-ethyl-4-pentylphenyl)-7-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]heptyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 166645851) has the molecular formula C28H44O6 and a molecular weight of 476.65 g/mol. Its IUPAC name is [4-(3-ethyl-4-pentylphenyl)-7-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]heptyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-(3-ethyl-4-pentylphenyl)-7-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]heptyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 166645851 |
| Molecular Formula | C28H44O6 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.31 |
| IUPAC Name | [4-(3-ethyl-4-pentylphenyl)-7-[1-hydroxy-2-(hydroxymethyl)prop-2-enoxy]heptyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCCC(CCCOC(O)C(=C)CO)c1ccc(CCCCC)c(CC)c1 |
| InChI | InChI=1S/C28H44O6/c1-5-7-8-11-25-14-15-26(18-23(25)6-2)24(12-9-16-33-27(31)21(3)19-29)13-10-17-34-28(32)22(4)20-30/h14-15,18,24,27,29-31H,3-13,16-17,19-20H2,1-2H3 |
| InChIKey | JBPKNHXFSIGIEJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|