C26H38O6 — CID 139525199
[4-(3-ethyl-4-pentylphenyl)-7-(2-hydroxyprop-2-enoyloxy)heptyl] 2-hydroxyprop-2-enoate (PubChem CID 139525199) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [4-(3-ethyl-4-pentylphenyl)-7-(2-hydroxyprop-2-enoyloxy)heptyl] 2-hydroxyprop-2-enoate.
| Compound Name | [4-(3-ethyl-4-pentylphenyl)-7-(2-hydroxyprop-2-enoyloxy)heptyl] 2-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 139525199 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [4-(3-ethyl-4-pentylphenyl)-7-(2-hydroxyprop-2-enoyloxy)heptyl] 2-hydroxyprop-2-enoate |
| SMILES | C=C(O)C(=O)OCCCC(CCCOC(=O)C(=C)O)c1ccc(CCCCC)c(CC)c1 |
| InChI | InChI=1S/C26H38O6/c1-5-7-8-11-23-14-15-24(18-21(23)6-2)22(12-9-16-31-25(29)19(3)27)13-10-17-32-26(30)20(4)28/h14-15,18,22,27-28H,3-13,16-17H2,1-2H3 |
| InChIKey | GJLMWOQLHULPRI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|