C28H33FO6 — CID 134245790
[2-[4-(3-fluoro-4-pentylphenyl)phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245790) has the molecular formula C28H33FO6 and a molecular weight of 484.56 g/mol. Its IUPAC name is [2-[4-(3-fluoro-4-pentylphenyl)phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[4-(3-fluoro-4-pentylphenyl)phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245790 |
| Molecular Formula | C28H33FO6 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [2-[4-(3-fluoro-4-pentylphenyl)phenyl]-3-[2-(hydroxymethyl)prop-2-enoyloxy]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCC(COC(=O)C(=C)CO)c1ccc(-c2ccc(CCCCC)c(F)c2)cc1 |
| InChI | InChI=1S/C28H33FO6/c1-4-5-6-7-23-12-13-24(14-26(23)29)21-8-10-22(11-9-21)25(17-34-27(32)19(2)15-30)18-35-28(33)20(3)16-31/h8-14,25,30-31H,2-7,15-18H2,1H3 |
| InChIKey | ORFJBGHVPNHBIE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|