C37H43FO6 — CID 147214669
[2-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-3-(3-hydroxy-2-methylidenebutanoyl)oxypropyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 147214669) has the molecular formula C37H43FO6 and a molecular weight of 602.74 g/mol. Its IUPAC name is [2-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-3-(3-hydroxy-2-methylidenebutanoyl)oxypropyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [2-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-3-(3-hydroxy-2-methylidenebutanoyl)oxypropyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 147214669 |
| Molecular Formula | C37H43FO6 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | [2-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]-3-(3-hydroxy-2-methylidenebutanoyl)oxypropyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC(COC(=O)C(=C)C(C)(C)O)c1ccc(-c2ccc(-c3ccc(CCCCC)cc3)cc2F)cc1)C(C)O |
| InChI | InChI=1S/C37H43FO6/c1-7-8-9-10-27-11-13-28(14-12-27)31-19-20-33(34(38)21-31)30-17-15-29(16-18-30)32(22-43-35(40)24(2)26(4)39)23-44-36(41)25(3)37(5,6)42/h11-21,26,32,39,42H,2-3,7-10,22-23H2,1,4-6H3 |
| InChIKey | CFWNCZIAUSVSNF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|