C41H52O5 — CID 153304360
[5-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)pentyl] 3-hydroxy-3-methyl-2-methylidenebutanoate (PubChem CID 153304360) has the molecular formula C41H52O5 and a molecular weight of 624.86 g/mol. Its IUPAC name is [5-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)pentyl] 3-hydroxy-3-methyl-2-methylidenebutanoate.
| Compound Name | [5-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)pentyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 153304360 |
| Molecular Formula | C41H52O5 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.38 |
| IUPAC Name | [5-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]phenyl]-2-(2-methylprop-2-enoyloxymethyl)pentyl] 3-hydroxy-3-methyl-2-methylidenebutanoate |
| SMILES | C=C(C)C(=O)OCC(CCCc1ccc(-c2ccc(-c3ccc(CCCCC)cc3)c(CC)c2)cc1)COC(=O)C(=C)C(C)(C)O |
| InChI | InChI=1S/C41H52O5/c1-8-10-11-13-31-18-22-36(23-19-31)38-25-24-37(26-34(38)9-2)35-20-16-32(17-21-35)14-12-15-33(27-45-39(42)29(3)4)28-46-40(43)30(5)41(6,7)44/h16-26,33,44H,3,5,8-15,27-28H2,1-2,4,6-7H3 |
| InChIKey | XMCJFJUSZNUQHZ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|