C42H50O3 — CID 138529257
[2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 138529257) has the molecular formula C42H50O3 and a molecular weight of 602.86 g/mol. Its IUPAC name is [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 138529257 |
| Molecular Formula | C42H50O3 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.38 |
| IUPAC Name | [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)Cc1ccc(CCc2ccc(-c3ccc(-c4ccc(CCCCC)c(CC)c4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C42H50O3/c1-6-8-9-10-37-21-22-40(27-36(37)7-2)41-24-23-39(25-31(41)5)38-19-17-33(18-20-38)12-11-32-13-15-34(16-14-32)26-35(28-43)29-45-42(44)30(3)4/h13-25,27,35,43H,3,6-12,26,28-29H2,1-2,4-5H3 |
| InChIKey | OBSJFHHRSMKHQF-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|