C32H44O6 — CID 145411857
5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal;[3-hydroxy-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-methylprop-2-enoate (PubChem CID 145411857) has the molecular formula C32H44O6 and a molecular weight of 524.70 g/mol. Its IUPAC name is 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal;[3-hydroxy-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-methylprop-2-enoate.
| Compound Name | 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal;[3-hydroxy-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145411857 |
| Molecular Formula | C32H44O6 |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | 5-hydroxy-4-(hydroxymethyl)-2-methylidenepentanal;[3-hydroxy-2-[4-(3-methyl-4-pentylphenyl)phenyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)c1ccc(-c2ccc(CCCCC)c(C)c2)cc1.C=C(C=O)CC(CO)CO |
| InChI | InChI=1S/C25H32O3.C7H12O3/c1-5-6-7-8-20-9-14-23(15-19(20)4)21-10-12-22(13-11-21)24(16-26)17-28-25(27)18(2)3;1-6(3-8)2-7(4-9)5-10/h9-15,24,26H,2,5-8,16-17H2,1,3-4H3;3,7,9-10H,1-2,4-5H2 |
| InChIKey | HGLLKGSWAWZMGU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|