C31H42O7 — CID 145411822
2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]phenyl]propyl] 2-methylprop-2-enoate (PubChem CID 145411822) has the molecular formula C31H42O7 and a molecular weight of 526.67 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]phenyl]propyl] 2-methylprop-2-enoate.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]phenyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145411822 |
| Molecular Formula | C31H42O7 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;[3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]phenyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC)c1ccc(OCCOc2ccc(CCCCC)cc2)cc1.C=C(C=O)CO |
| InChI | InChI=1S/C27H36O5.C4H6O2/c1-5-6-7-8-22-9-13-25(14-10-22)30-17-18-31-26-15-11-23(12-16-26)24(19-29-4)20-32-27(28)21(2)3;1-4(2-5)3-6/h9-16,24H,2,5-8,17-20H2,1,3-4H3;2,6H,1,3H2 |
| InChIKey | KJLJGIINFBLHBW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|