C23H36O6 — CID 145411671
2-(hydroxymethyl)prop-2-enal;3-[3-methoxy-2-(4-methoxyphenyl)propoxy]-2-methylidenebut-3-en-1-ol;propane (PubChem CID 145411671) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;3-[3-methoxy-2-(4-methoxyphenyl)propoxy]-2-methylidenebut-3-en-1-ol;propane.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;3-[3-methoxy-2-(4-methoxyphenyl)propoxy]-2-methylidenebut-3-en-1-ol;propane |
|---|---|
| PubChem CID | 145411671 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;3-[3-methoxy-2-(4-methoxyphenyl)propoxy]-2-methylidenebut-3-en-1-ol;propane |
| SMILES | C=C(C=O)CO.C=C(CO)C(=C)OCC(COC)c1ccc(OC)cc1.CCC |
| InChI | InChI=1S/C16H22O4.C4H6O2.C3H8/c1-12(9-17)13(2)20-11-15(10-18-3)14-5-7-16(19-4)8-6-14;1-4(2-5)3-6;1-3-2/h5-8,15,17H,1-2,9-11H2,3-4H3;2,6H,1,3H2;3H2,1-2H3 |
| InChIKey | TVDHNPFVUGDKDW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|