About 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate
4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate (PubChem CID 23522371) has the molecular formula C18H28O4
and a molecular weight of 308.42 g/mol. Its IUPAC name is 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate.
Molecular Properties
| Compound Name | 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate |
| PubChem CID | 23522371 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate |
| SMILES | CCC(CC(C)C(=O)OCCCCO)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28O4/c1-4-15(16-7-9-17(21-3)10-8-16)13-14(2)18(20)22-12-6-5-11-19/h7-10,14-15,19H,4-6,11-13H2,1-3H3 |
| InChIKey | UZZYFDQQDCBGRN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate?
The IUPAC name of 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate (CID 23522371) is 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate.
What is the SMILES notation for 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate?
The canonical SMILES for 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate is CCC(CC(C)C(=O)OCCCCO)c1ccc(OC)cc1.
What is the InChIKey of 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate?
The InChIKey is UZZYFDQQDCBGRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O4/c1-4-15(16-7-9-17(21-3)10-8-16)13-14(2)18(20)22-12-6-5-11-19/h7-10,14-15,19H,4-6,11-13H2,1-3H3.
What are the key properties of 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate?
4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate has a molecular weight of 308.42 g/mol, XLogP of 3.53, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl 4-(4-methoxyphenyl)-2-methylhexanoate is sourced from PubChem (CID 23522371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).