About 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane
4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane (PubChem CID 142449144) has the molecular formula C23H35NO2
and a molecular weight of 357.54 g/mol. Its IUPAC name is 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane |
| PubChem CID | 142449144 |
| Molecular Formula | C23H35NO2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.27 |
| IUPAC Name | 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane |
| SMILES | CCC.CCC(CC(C)=O)c1ccc(N)cc1.COc1ccc(C)cc1 |
| InChI | InChI=1S/C12H17NO.C8H10O.C3H8/c1-3-10(8-9(2)14)11-4-6-12(13)7-5-11;1-7-3-5-8(9-2)6-4-7;1-3-2/h4-7,10H,3,8,13H2,1-2H3;3-6H,1-2H3;3H2,1-2H3 |
| InChIKey | SKEOJMISKJUDLB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane?
The IUPAC name of 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane (CID 142449144) is 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane.
What is the SMILES notation for 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane?
The canonical SMILES for 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane is CCC.CCC(CC(C)=O)c1ccc(N)cc1.COc1ccc(C)cc1.
What is the InChIKey of 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane?
The InChIKey is SKEOJMISKJUDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C8H10O.C3H8/c1-3-10(8-9(2)14)11-4-6-12(13)7-5-11;1-7-3-5-8(9-2)6-4-7;1-3-2/h4-7,10H,3,8,13H2,1-2H3;3-6H,1-2H3;3H2,1-2H3.
What are the key properties of 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane?
4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane has a molecular weight of 357.54 g/mol, XLogP of 6.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)hexan-2-one;1-methoxy-4-methylbenzene;propane is sourced from PubChem (CID 142449144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).