C44H56O6 — CID 142282317
2-(1,3-dimethoxypropan-2-yl)-6-[6-(4-pentylcyclohexyl)naphthalen-2-yl]naphthalene;bis(2-(hydroxymethyl)prop-2-enal) (PubChem CID 142282317) has the molecular formula C44H56O6 and a molecular weight of 680.93 g/mol. Its IUPAC name is 2-(1,3-dimethoxypropan-2-yl)-6-[6-(4-pentylcyclohexyl)naphthalen-2-yl]naphthalene;bis(2-(hydroxymethyl)prop-2-enal).
| Compound Name | 2-(1,3-dimethoxypropan-2-yl)-6-[6-(4-pentylcyclohexyl)naphthalen-2-yl]naphthalene;bis(2-(hydroxymethyl)prop-2-enal) |
|---|---|
| PubChem CID | 142282317 |
| Molecular Formula | C44H56O6 |
| Molecular Weight | 680.93 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | 2-(1,3-dimethoxypropan-2-yl)-6-[6-(4-pentylcyclohexyl)naphthalen-2-yl]naphthalene;bis(2-(hydroxymethyl)prop-2-enal) |
| SMILES | C=C(C=O)CO.C=C(C=O)CO.CCCCCC1CCC(c2ccc3cc(-c4ccc5cc(C(COC)COC)ccc5c4)ccc3c2)CC1 |
| InChI | InChI=1S/C36H44O2.2C4H6O2/c1-4-5-6-7-26-8-10-27(11-9-26)28-12-13-30-21-31(15-14-29(30)20-28)32-16-17-34-23-35(19-18-33(34)22-32)36(24-37-2)25-38-3;2*1-4(2-5)3-6/h12-23,26-27,36H,4-11,24-25H2,1-3H3;2*2,6H,1,3H2 |
| InChIKey | ZYZVNBISMYYSRM-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.93 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|