C27H42O5 — CID 142281764
[3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]cyclohexyl]propyl] 2-methylprop-2-enoate (PubChem CID 142281764) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is [3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]cyclohexyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]cyclohexyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 142281764 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [3-methoxy-2-[4-[2-(4-pentylphenoxy)ethoxy]cyclohexyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC)C1CCC(OCCOc2ccc(CCCCC)cc2)CC1 |
| InChI | InChI=1S/C27H42O5/c1-5-6-7-8-22-9-13-25(14-10-22)30-17-18-31-26-15-11-23(12-16-26)24(19-29-4)20-32-27(28)21(2)3/h9-10,13-14,23-24,26H,2,5-8,11-12,15-20H2,1,3-4H3 |
| InChIKey | ZDGWWVCLVDQUPV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|