C26H40O5 — CID 142281577
[2-(4-formylcyclohexyl)-3-hydroxypropyl] 2-methylprop-2-enoate;1-methoxy-4-pentylbenzene (PubChem CID 142281577) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is [2-(4-formylcyclohexyl)-3-hydroxypropyl] 2-methylprop-2-enoate;1-methoxy-4-pentylbenzene.
| Compound Name | [2-(4-formylcyclohexyl)-3-hydroxypropyl] 2-methylprop-2-enoate;1-methoxy-4-pentylbenzene |
|---|---|
| PubChem CID | 142281577 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [2-(4-formylcyclohexyl)-3-hydroxypropyl] 2-methylprop-2-enoate;1-methoxy-4-pentylbenzene |
| SMILES | C=C(C)C(=O)OCC(CO)C1CCC(C=O)CC1.CCCCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H22O4.C12H18O/c1-10(2)14(17)18-9-13(8-16)12-5-3-11(7-15)4-6-12;1-3-4-5-6-11-7-9-12(13-2)10-8-11/h7,11-13,16H,1,3-6,8-9H2,2H3;7-10H,3-6H2,1-2H3 |
| InChIKey | SJQYCTBNWNQTCD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|