C30H44F2O3 — CID 134246239
[2-[4-[4-(2,3-difluoro-4-pentylphenyl)cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 134246239) has the molecular formula C30H44F2O3 and a molecular weight of 490.68 g/mol. Its IUPAC name is [2-[4-[4-(2,3-difluoro-4-pentylphenyl)cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-[4-(2,3-difluoro-4-pentylphenyl)cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134246239 |
| Molecular Formula | C30H44F2O3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | [2-[4-[4-(2,3-difluoro-4-pentylphenyl)cyclohexyl]cyclohexyl]-3-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CO)C1CCC(C2CCC(c3ccc(CCCCC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C30H44F2O3/c1-4-5-6-7-25-16-17-27(29(32)28(25)31)24-14-12-22(13-15-24)21-8-10-23(11-9-21)26(18-33)19-35-30(34)20(2)3/h16-17,21-24,26,33H,2,4-15,18-19H2,1,3H3 |
| InChIKey | GXPGFVWXJBMXMX-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|