C44H49ClO5 — CID 134246084
[2-[[4-[3-chloro-4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246084) has the molecular formula C44H49ClO5 and a molecular weight of 693.32 g/mol. Its IUPAC name is [2-[[4-[3-chloro-4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-[[4-[3-chloro-4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246084 |
| Molecular Formula | C44H49ClO5 |
| Molecular Weight | 693.32 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | [2-[[4-[3-chloro-4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]phenyl]methyl]-3-(2-methylprop-2-enoyloxy)propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)Cc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCC)c(CC)c4)c(C)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C44H49ClO5/c1-7-9-10-11-35-16-17-39(24-34(35)8-2)40-20-19-38(22-30(40)5)41-21-18-37(25-42(41)45)36-14-12-32(13-15-36)23-33(27-49-43(47)29(3)4)28-50-44(48)31(6)26-46/h12-22,24-25,33,46H,3,6-11,23,26-28H2,1-2,4-5H3 |
| InChIKey | LRSNJHBOQXXDEW-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.32 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|