C43H54O6 — CID 142282053
[4-[4-[3-ethyl-4-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)phenyl]-3-methylphenyl]-2-(hydroxymethyl)butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal (PubChem CID 142282053) has the molecular formula C43H54O6 and a molecular weight of 666.90 g/mol. Its IUPAC name is [4-[4-[3-ethyl-4-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)phenyl]-3-methylphenyl]-2-(hydroxymethyl)butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal.
| Compound Name | [4-[4-[3-ethyl-4-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)phenyl]-3-methylphenyl]-2-(hydroxymethyl)butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 142282053 |
| Molecular Formula | C43H54O6 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | [4-[4-[3-ethyl-4-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)phenyl]-3-methylphenyl]-2-(hydroxymethyl)butyl] 2-(hydroxymethyl)prop-2-enoate;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(CO)CCc1ccc(-c2ccc(C3=CC4C=CC(CCCCC)=CC4C=C3)c(CC)c2)c(C)c1 |
| InChI | InChI=1S/C39H48O4.C4H6O2/c1-5-7-8-9-29-12-14-34-23-36(16-15-33(34)21-29)38-19-17-35(22-32(38)6-2)37-18-13-30(20-27(37)3)10-11-31(25-41)26-43-39(42)28(4)24-40;1-4(2-5)3-6/h12-23,31,33-34,40-41H,4-11,24-26H2,1-3H3;2,6H,1,3H2 |
| InChIKey | YKNLQGVWCTZNFJ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|