C35H50O — CID 142283071
6-[3-ethyl-4-[2-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)ethyl]phenyl]-2-(2-methylprop-2-enyl)hexan-1-ol (PubChem CID 142283071) has the molecular formula C35H50O and a molecular weight of 486.78 g/mol. Its IUPAC name is 6-[3-ethyl-4-[2-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)ethyl]phenyl]-2-(2-methylprop-2-enyl)hexan-1-ol.
| Compound Name | 6-[3-ethyl-4-[2-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)ethyl]phenyl]-2-(2-methylprop-2-enyl)hexan-1-ol |
|---|---|
| PubChem CID | 142283071 |
| Molecular Formula | C35H50O |
| Molecular Weight | 486.78 g/mol |
| Exact Mass | 486.39 |
| IUPAC Name | 6-[3-ethyl-4-[2-(6-pentyl-4a,8a-dihydronaphthalen-2-yl)ethyl]phenyl]-2-(2-methylprop-2-enyl)hexan-1-ol |
| SMILES | C=C(C)CC(CO)CCCCc1ccc(CCC2=CC3C=CC(CCCCC)=CC3C=C2)c(CC)c1 |
| InChI | InChI=1S/C35H50O/c1-5-7-8-11-29-16-20-35-25-30(17-21-34(35)24-29)15-19-33-18-14-28(23-32(33)6-2)12-9-10-13-31(26-36)22-27(3)4/h14,16-18,20-21,23-25,31,34-36H,3,5-13,15,19,22,26H2,1-2,4H3 |
| InChIKey | AKLGACWBRMXPDX-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.78 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|