C40H56O4 — CID 134245202
[2-[[4-[3-ethyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]methyl]-4-[3-(hydroxymethyl)buta-1,3-dien-2-yloxy]butyl] 2-methylprop-2-enoate (PubChem CID 134245202) has the molecular formula C40H56O4 and a molecular weight of 600.88 g/mol. Its IUPAC name is [2-[[4-[3-ethyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]methyl]-4-[3-(hydroxymethyl)buta-1,3-dien-2-yloxy]butyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[3-ethyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]methyl]-4-[3-(hydroxymethyl)buta-1,3-dien-2-yloxy]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134245202 |
| Molecular Formula | C40H56O4 |
| Molecular Weight | 600.88 g/mol |
| Exact Mass | 600.42 |
| IUPAC Name | [2-[[4-[3-ethyl-4-(3-methyl-4-pentylphenyl)phenyl]cyclohexyl]methyl]-4-[3-(hydroxymethyl)buta-1,3-dien-2-yloxy]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCOC(=C)C(=C)CO)CC1CCC(c2ccc(-c3ccc(CCCCC)c(C)c3)c(CC)c2)CC1 |
| InChI | InChI=1S/C40H56O4/c1-8-10-11-12-35-17-18-38(23-29(35)5)39-20-19-37(25-34(39)9-2)36-15-13-32(14-16-36)24-33(27-44-40(42)28(3)4)21-22-43-31(7)30(6)26-41/h17-20,23,25,32-33,36,41H,3,6-16,21-22,24,26-27H2,1-2,4-5H3 |
| InChIKey | NBVQHTAYQAFBNI-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.88 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|