C38H46O8 — CID 135164161
2-[4-[2-ethyl-4-(2-methyl-4-pentylphenyl)phenyl]-2-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate (PubChem CID 135164161) has the molecular formula C38H46O8 and a molecular weight of 630.78 g/mol. Its IUPAC name is 2-[4-[2-ethyl-4-(2-methyl-4-pentylphenyl)phenyl]-2-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-[4-[2-ethyl-4-(2-methyl-4-pentylphenyl)phenyl]-2-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 135164161 |
| Molecular Formula | C38H46O8 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | 2-[4-[2-ethyl-4-(2-methyl-4-pentylphenyl)phenyl]-2-[2-[2-(hydroxymethyl)prop-2-enoyloxy]ethoxy]phenoxy]ethyl 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCOc1ccc(-c2ccc(-c3ccc(CCCCC)cc3C)cc2CC)cc1OCCOC(=O)C(=C)CO |
| InChI | InChI=1S/C38H46O8/c1-6-8-9-10-29-11-14-33(26(3)21-29)31-12-15-34(30(7-2)22-31)32-13-16-35(43-17-19-45-37(41)27(4)24-39)36(23-32)44-18-20-46-38(42)28(5)25-40/h11-16,21-23,39-40H,4-10,17-20,24-25H2,1-3H3 |
| InChIKey | LFKVGJIQUQTAGQ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|