C32H40F2O6 — CID 139525424
[3-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]pentyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 139525424) has the molecular formula C32H40F2O6 and a molecular weight of 558.66 g/mol. Its IUPAC name is [3-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]pentyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [3-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]pentyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 139525424 |
| Molecular Formula | C32H40F2O6 |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | [3-[2-fluoro-4-(2-fluoro-4-heptylphenyl)phenyl]-5-[2-(hydroxymethyl)prop-2-enoyloxy]pentyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)OCCC(CCOC(=O)C(=C)CO)c1ccc(-c2ccc(CCCCCCC)cc2F)cc1F |
| InChI | InChI=1S/C32H40F2O6/c1-4-5-6-7-8-9-24-10-12-28(29(33)18-24)26-11-13-27(30(34)19-26)25(14-16-39-31(37)22(2)20-35)15-17-40-32(38)23(3)21-36/h10-13,18-19,25,35-36H,2-9,14-17,20-21H2,1H3 |
| InChIKey | DGSZIYUWVMFBOQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|