C25H30F2O3 — CID 134244745
[3-[4-(4-butylphenyl)-2,3-difluorophenyl]-5-hydroxypentyl] 2-methylprop-2-enoate (PubChem CID 134244745) has the molecular formula C25H30F2O3 and a molecular weight of 416.51 g/mol. Its IUPAC name is [3-[4-(4-butylphenyl)-2,3-difluorophenyl]-5-hydroxypentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-(4-butylphenyl)-2,3-difluorophenyl]-5-hydroxypentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244745 |
| Molecular Formula | C25H30F2O3 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [3-[4-(4-butylphenyl)-2,3-difluorophenyl]-5-hydroxypentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCO)c1ccc(-c2ccc(CCCC)cc2)c(F)c1F |
| InChI | InChI=1S/C25H30F2O3/c1-4-5-6-18-7-9-19(10-8-18)21-11-12-22(24(27)23(21)26)20(13-15-28)14-16-30-25(29)17(2)3/h7-12,20,28H,2,4-6,13-16H2,1,3H3 |
| InChIKey | YVGNHJLITVRXQZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|