C43H50O4 — CID 145411680
[2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-formyloxypropyl] 2-methylprop-2-enoate (PubChem CID 145411680) has the molecular formula C43H50O4 and a molecular weight of 630.87 g/mol. Its IUPAC name is [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-formyloxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-formyloxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145411680 |
| Molecular Formula | C43H50O4 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | [2-[[4-[2-[4-[4-(3-ethyl-4-pentylphenyl)-3-methylphenyl]phenyl]ethyl]phenyl]methyl]-3-formyloxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC=O)Cc1ccc(CCc2ccc(-c3ccc(-c4ccc(CCCCC)c(CC)c4)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C43H50O4/c1-6-8-9-10-38-21-22-41(27-37(38)7-2)42-24-23-40(25-32(42)5)39-19-17-34(18-20-39)12-11-33-13-15-35(16-14-33)26-36(28-46-30-44)29-47-43(45)31(3)4/h13-25,27,30,36H,3,6-12,26,28-29H2,1-2,4-5H3 |
| InChIKey | CUQZIWZYBAYYME-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|