C40H54F2O5 — CID 145411489
[2-[3-fluoro-4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-3-hydroxypropyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal (PubChem CID 145411489) has the molecular formula C40H54F2O5 and a molecular weight of 652.86 g/mol. Its IUPAC name is [2-[3-fluoro-4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-3-hydroxypropyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal.
| Compound Name | [2-[3-fluoro-4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-3-hydroxypropyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 145411489 |
| Molecular Formula | C40H54F2O5 |
| Molecular Weight | 652.86 g/mol |
| Exact Mass | 652.39 |
| IUPAC Name | [2-[3-fluoro-4-[3-fluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]phenyl]-3-hydroxypropyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C)C(=O)OCC(CO)c1ccc(-c2ccc(C3CCC(C4CCC(CCCCC)CC4)CC3)c(F)c2)c(F)c1.C=C(C=O)CO |
| InChI | InChI=1S/C36H48F2O3.C4H6O2/c1-4-5-6-7-25-8-10-26(11-9-25)27-12-14-28(15-13-27)32-19-17-30(21-35(32)38)33-18-16-29(20-34(33)37)31(22-39)23-41-36(40)24(2)3;1-4(2-5)3-6/h16-21,25-28,31,39H,2,4-15,22-23H2,1,3H3;2,6H,1,3H2 |
| InChIKey | MRGQCNFAKGSVIK-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.86 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|