C34H52O6 — CID 145411675
2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[6-[2-(4-pentylcyclohexyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411675) has the molecular formula C34H52O6 and a molecular weight of 556.78 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[6-[2-(4-pentylcyclohexyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[6-[2-(4-pentylcyclohexyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411675 |
| Molecular Formula | C34H52O6 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.38 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[6-[2-(4-pentylcyclohexyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(CO)c1ccc2c(c1)CCC(CCC1CCC(CCCCC)CC1)C2 |
| InChI | InChI=1S/C30H46O4.C4H6O2/c1-3-4-5-6-23-7-9-24(10-8-23)11-12-25-13-14-27-18-28(16-15-26(27)17-25)29(20-32)21-34-30(33)22(2)19-31;1-4(2-5)3-6/h15-16,18,23-25,29,31-32H,2-14,17,19-21H2,1H3;2,6H,1,3H2 |
| InChIKey | VGTHYPZKHXSQKB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|