C44H55F3O5 — CID 145411831
[4-[2,6-difluoro-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]cyclohexyl]phenyl]-7-hydroxyheptyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal (PubChem CID 145411831) has the molecular formula C44H55F3O5 and a molecular weight of 720.91 g/mol. Its IUPAC name is [4-[2,6-difluoro-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]cyclohexyl]phenyl]-7-hydroxyheptyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal.
| Compound Name | [4-[2,6-difluoro-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]cyclohexyl]phenyl]-7-hydroxyheptyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 145411831 |
| Molecular Formula | C44H55F3O5 |
| Molecular Weight | 720.91 g/mol |
| Exact Mass | 720.40 |
| IUPAC Name | [4-[2,6-difluoro-4-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]cyclohexyl]phenyl]-7-hydroxyheptyl] 2-methylprop-2-enoate;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C)C(=O)OCCCC(CCCO)c1c(F)cc(C2CCC(c3ccc(-c4ccc(CCCCC)cc4)cc3F)CC2)cc1F.C=C(C=O)CO |
| InChI | InChI=1S/C40H49F3O3.C4H6O2/c1-4-5-6-9-28-12-14-29(15-13-28)33-20-21-35(36(41)24-33)31-18-16-30(17-19-31)34-25-37(42)39(38(43)26-34)32(10-7-22-44)11-8-23-46-40(45)27(2)3;1-4(2-5)3-6/h12-15,20-21,24-26,30-32,44H,2,4-11,16-19,22-23H2,1,3H3;2,6H,1,3H2 |
| InChIKey | ZUNSILXRXPBEIO-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.91 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|