C48H64O5 — CID 134246102
[4-[4-[2-ethyl-4-[4-(2-ethyl-4-pentylphenyl)phenyl]phenyl]cyclohexyl]-7-(2-methylprop-2-enoyloxy)heptyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134246102) has the molecular formula C48H64O5 and a molecular weight of 721.03 g/mol. Its IUPAC name is [4-[4-[2-ethyl-4-[4-(2-ethyl-4-pentylphenyl)phenyl]phenyl]cyclohexyl]-7-(2-methylprop-2-enoyloxy)heptyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[2-ethyl-4-[4-(2-ethyl-4-pentylphenyl)phenyl]phenyl]cyclohexyl]-7-(2-methylprop-2-enoyloxy)heptyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134246102 |
| Molecular Formula | C48H64O5 |
| Molecular Weight | 721.03 g/mol |
| Exact Mass | 720.48 |
| IUPAC Name | [4-[4-[2-ethyl-4-[4-(2-ethyl-4-pentylphenyl)phenyl]phenyl]cyclohexyl]-7-(2-methylprop-2-enoyloxy)heptyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCOC(=O)C(=C)CO)C1CCC(c2ccc(-c3ccc(-c4ccc(CCCCC)cc4CC)cc3)cc2CC)CC1 |
| InChI | InChI=1S/C48H64O5/c1-7-10-11-14-36-17-27-45(37(8-2)31-36)42-24-20-41(21-25-42)44-26-28-46(38(9-3)32-44)43-22-18-40(19-23-43)39(15-12-29-52-47(50)34(4)5)16-13-30-53-48(51)35(6)33-49/h17,20-21,24-28,31-32,39-40,43,49H,4,6-16,18-19,22-23,29-30,33H2,1-3,5H3 |
| InChIKey | YBNNVPJLHNYBJV-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.03 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|